About 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride
4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride (PubChem CID 67442691) has the molecular formula C21H34Cl2N2O
and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride.
Molecular Properties
| Compound Name | 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride |
| PubChem CID | 67442691 |
| Molecular Formula | C21H34Cl2N2O |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride |
| SMILES | Cc1cccc(C)c1/C=C/C1CCN(CCN2CCOCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C21H32N2O.2ClH/c1-18-4-3-5-19(2)21(18)7-6-20-8-10-22(11-9-20)12-13-23-14-16-24-17-15-23;;/h3-7,20H,8-17H2,1-2H3;2*1H/b7-6+;; |
| InChIKey | JEIMFPCGSOXWBG-KMXZHCNGSA-N |
| XLogP | 4.20 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride?
The IUPAC name of 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride (CID 67442691) is 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride.
What is the SMILES notation for 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride?
The canonical SMILES for 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride is Cc1cccc(C)c1/C=C/C1CCN(CCN2CCOCC2)CC1.Cl.Cl.
What is the InChIKey of 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride?
The InChIKey is JEIMFPCGSOXWBG-KMXZHCNGSA-N. The full InChI is InChI=1S/C21H32N2O.2ClH/c1-18-4-3-5-19(2)21(18)7-6-20-8-10-22(11-9-20)12-13-23-14-16-24-17-15-23;;/h3-7,20H,8-17H2,1-2H3;2*1H/b7-6+;;.
What are the key properties of 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride?
4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride has a molecular weight of 401.42 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-[(E)-2-(2,6-dimethylphenyl)ethenyl]piperidin-1-yl]ethyl]morpholine;dihydrochloride is sourced from PubChem (CID 67442691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).