C6H4IN3S — CID 67444271
6-iodo-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 67444271) has the molecular formula C6H4IN3S and a molecular weight of 277.09 g/mol. Its IUPAC name is 6-iodo-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 6-iodo-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 67444271 |
| Molecular Formula | C6H4IN3S |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 276.92 |
| IUPAC Name | 6-iodo-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | S=c1[nH]nc2ccc(I)cn12 |
| InChI | InChI=1S/C6H4IN3S/c7-4-1-2-5-8-9-6(11)10(5)3-4/h1-3H,(H,9,11) |
| InChIKey | MDRHRCGHFZOVDC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|