About 1-fluoroisoquinoline;1,3-thiazole
1-fluoroisoquinoline;1,3-thiazole (PubChem CID 67444968) has the molecular formula C12H9FN2S
and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-fluoroisoquinoline;1,3-thiazole.
Molecular Properties
| Compound Name | 1-fluoroisoquinoline;1,3-thiazole |
| PubChem CID | 67444968 |
| Molecular Formula | C12H9FN2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-fluoroisoquinoline;1,3-thiazole |
| SMILES | Fc1nccc2ccccc12.c1cscn1 |
| InChI | InChI=1S/C9H6FN.C3H3NS/c10-9-8-4-2-1-3-7(8)5-6-11-9;1-2-5-3-4-1/h1-6H;1-3H |
| InChIKey | RPLWBHFXZRVCPW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroisoquinoline;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroisoquinoline;1,3-thiazole?
The IUPAC name of 1-fluoroisoquinoline;1,3-thiazole (CID 67444968) is 1-fluoroisoquinoline;1,3-thiazole.
What is the SMILES notation for 1-fluoroisoquinoline;1,3-thiazole?
The canonical SMILES for 1-fluoroisoquinoline;1,3-thiazole is Fc1nccc2ccccc12.c1cscn1.
What is the InChIKey of 1-fluoroisoquinoline;1,3-thiazole?
The InChIKey is RPLWBHFXZRVCPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FN.C3H3NS/c10-9-8-4-2-1-3-7(8)5-6-11-9;1-2-5-3-4-1/h1-6H;1-3H.
What are the key properties of 1-fluoroisoquinoline;1,3-thiazole?
1-fluoroisoquinoline;1,3-thiazole has a molecular weight of 232.28 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroisoquinoline;1,3-thiazole is sourced from PubChem (CID 67444968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).