About N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine
N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine (PubChem CID 67445098) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine.
Molecular Properties
| Compound Name | N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine |
| PubChem CID | 67445098 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine |
| SMILES | c1cn2cc(NC3CCCCC3)cnc2n1 |
| InChI | InChI=1S/C12H16N4/c1-2-4-10(5-3-1)15-11-8-14-12-13-6-7-16(12)9-11/h6-10,15H,1-5H2 |
| InChIKey | UZBXFPWYARWLGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine?
The IUPAC name of N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine (CID 67445098) is N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine.
What is the SMILES notation for N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine?
The canonical SMILES for N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine is c1cn2cc(NC3CCCCC3)cnc2n1.
What is the InChIKey of N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine?
The InChIKey is UZBXFPWYARWLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-2-4-10(5-3-1)15-11-8-14-12-13-6-7-16(12)9-11/h6-10,15H,1-5H2.
What are the key properties of N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine?
N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine has a molecular weight of 216.29 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylimidazo[1,2-a]pyrimidin-6-amine is sourced from PubChem (CID 67445098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).