C33H33N7O6 — CID 67445648
5-oxo-4-(phenylmethoxycarbonylamino)-5-[[8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-yl]amino]pentanoic acid (PubChem CID 67445648) has the molecular formula C33H33N7O6 and a molecular weight of 623.67 g/mol. Its IUPAC name is 5-oxo-4-(phenylmethoxycarbonylamino)-5-[[8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-yl]amino]pentanoic acid.
| Compound Name | 5-oxo-4-(phenylmethoxycarbonylamino)-5-[[8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 67445648 |
| Molecular Formula | C33H33N7O6 |
| Molecular Weight | 623.67 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | 5-oxo-4-(phenylmethoxycarbonylamino)-5-[[8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-yl]amino]pentanoic acid |
| SMILES | O=C(O)CCC(NC(=O)OCc1ccccc1)C(=O)Nc1ccc2cccc(OCC3CCCN3c3ncnc4nc[nH]c34)c2c1 |
| InChI | InChI=1S/C33H33N7O6/c41-28(42)14-13-26(39-33(44)46-17-21-6-2-1-3-7-21)32(43)38-23-12-11-22-8-4-10-27(25(22)16-23)45-18-24-9-5-15-40(24)31-29-30(35-19-34-29)36-20-37-31/h1-4,6-8,10-12,16,19-20,24,26H,5,9,13-15,17-18H2,(H,38,43)(H,39,44)(H,41,42)(H,34,35,36,37) |
| InChIKey | CAGKACUMVCMPMF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 171.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |