About 2-benzyl-6-bromo-1,3-dihydroindazole
2-benzyl-6-bromo-1,3-dihydroindazole (PubChem CID 67445953) has the molecular formula C14H13BrN2
and a molecular weight of 289.18 g/mol. Its IUPAC name is 2-benzyl-6-bromo-1,3-dihydroindazole.
Molecular Properties
| Compound Name | 2-benzyl-6-bromo-1,3-dihydroindazole |
| PubChem CID | 67445953 |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-benzyl-6-bromo-1,3-dihydroindazole |
| SMILES | Brc1ccc2c(c1)NN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H13BrN2/c15-13-7-6-12-10-17(16-14(12)8-13)9-11-4-2-1-3-5-11/h1-8,16H,9-10H2 |
| InChIKey | RQYZCSCJOJDQTE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-6-bromo-1,3-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-bromo-1,3-dihydroindazole?
The IUPAC name of 2-benzyl-6-bromo-1,3-dihydroindazole (CID 67445953) is 2-benzyl-6-bromo-1,3-dihydroindazole.
What is the SMILES notation for 2-benzyl-6-bromo-1,3-dihydroindazole?
The canonical SMILES for 2-benzyl-6-bromo-1,3-dihydroindazole is Brc1ccc2c(c1)NN(Cc1ccccc1)C2.
What is the InChIKey of 2-benzyl-6-bromo-1,3-dihydroindazole?
The InChIKey is RQYZCSCJOJDQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2/c15-13-7-6-12-10-17(16-14(12)8-13)9-11-4-2-1-3-5-11/h1-8,16H,9-10H2.
What are the key properties of 2-benzyl-6-bromo-1,3-dihydroindazole?
2-benzyl-6-bromo-1,3-dihydroindazole has a molecular weight of 289.18 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-bromo-1,3-dihydroindazole is sourced from PubChem (CID 67445953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).