C19H22ClN5O — CID 67446869
1-ethyl-3-[8-methyl-6-(pyridin-4-ylmethylamino)isoquinolin-3-yl]urea;hydrochloride (PubChem CID 67446869) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-ethyl-3-[8-methyl-6-(pyridin-4-ylmethylamino)isoquinolin-3-yl]urea;hydrochloride.
| Compound Name | 1-ethyl-3-[8-methyl-6-(pyridin-4-ylmethylamino)isoquinolin-3-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 67446869 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-ethyl-3-[8-methyl-6-(pyridin-4-ylmethylamino)isoquinolin-3-yl]urea;hydrochloride |
| SMILES | CCNC(=O)Nc1cc2cc(NCc3ccncc3)cc(C)c2cn1.Cl |
| InChI | InChI=1S/C19H21N5O.ClH/c1-3-21-19(25)24-18-10-15-9-16(8-13(2)17(15)12-23-18)22-11-14-4-6-20-7-5-14;/h4-10,12,22H,3,11H2,1-2H3,(H2,21,23,24,25);1H |
| InChIKey | IFKIGVFZCQHBSB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |