C9H18O3Si — CID 67447426
2-ethenyl-2-methoxy-4,4,6-trimethyl-1,3,2-dioxasilinane (PubChem CID 67447426) has the molecular formula C9H18O3Si and a molecular weight of 202.33 g/mol. Its IUPAC name is 2-ethenyl-2-methoxy-4,4,6-trimethyl-1,3,2-dioxasilinane.
| Compound Name | 2-ethenyl-2-methoxy-4,4,6-trimethyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 67447426 |
| Molecular Formula | C9H18O3Si |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-ethenyl-2-methoxy-4,4,6-trimethyl-1,3,2-dioxasilinane |
| SMILES | C=C[Si]1(OC)OC(C)CC(C)(C)O1 |
| InChI | InChI=1S/C9H18O3Si/c1-6-13(10-5)11-8(2)7-9(3,4)12-13/h6,8H,1,7H2,2-5H3 |
| InChIKey | DQCKSOBKMQOVSX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|