C12H11Cl2N5O2 — CID 67447965
1-[4-(4-amino-2,3-dichlorophenoxy)pyrimidin-2-yl]-3-methylurea (PubChem CID 67447965) has the molecular formula C12H11Cl2N5O2 and a molecular weight of 328.16 g/mol. Its IUPAC name is 1-[4-(4-amino-2,3-dichlorophenoxy)pyrimidin-2-yl]-3-methylurea.
| Compound Name | 1-[4-(4-amino-2,3-dichlorophenoxy)pyrimidin-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 67447965 |
| Molecular Formula | C12H11Cl2N5O2 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 1-[4-(4-amino-2,3-dichlorophenoxy)pyrimidin-2-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1nccc(Oc2ccc(N)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H11Cl2N5O2/c1-16-12(20)19-11-17-5-4-8(18-11)21-7-3-2-6(15)9(13)10(7)14/h2-5H,15H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | YQIYDFGYYSIASF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|