C23H29ClN4O — CID 67448082
3-ethyl-1-phenyl-6-(1-piperidin-4-ylazetidin-3-yl)oxyindazole;hydrochloride (PubChem CID 67448082) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 3-ethyl-1-phenyl-6-(1-piperidin-4-ylazetidin-3-yl)oxyindazole;hydrochloride.
| Compound Name | 3-ethyl-1-phenyl-6-(1-piperidin-4-ylazetidin-3-yl)oxyindazole;hydrochloride |
|---|---|
| PubChem CID | 67448082 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-ethyl-1-phenyl-6-(1-piperidin-4-ylazetidin-3-yl)oxyindazole;hydrochloride |
| SMILES | CCc1nn(-c2ccccc2)c2cc(OC3CN(C4CCNCC4)C3)ccc12.Cl |
| InChI | InChI=1S/C23H28N4O.ClH/c1-2-22-21-9-8-19(14-23(21)27(25-22)18-6-4-3-5-7-18)28-20-15-26(16-20)17-10-12-24-13-11-17;/h3-9,14,17,20,24H,2,10-13,15-16H2,1H3;1H |
| InChIKey | YQLLXMXEULCCFK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |