C24H17NO8 — CID 67448179
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;3-hydroxypyrrolidine-2,5-dione (PubChem CID 67448179) has the molecular formula C24H17NO8 and a molecular weight of 447.40 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67448179 |
| Molecular Formula | C24H17NO8 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;3-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(O)C(=O)N1.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C4H5NO3/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;6-2-1-3(7)5-4(2)8/h1-10,21-22H;2,6H,1H2,(H,5,7,8) |
| InChIKey | KJGXTDAMKXGWSX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|