C24H32ClN5 — CID 67448706
3-ethyl-1-phenyl-6-(4-piperazin-1-ylpiperidin-1-yl)indazole;hydrochloride (PubChem CID 67448706) has the molecular formula C24H32ClN5 and a molecular weight of 426.01 g/mol. Its IUPAC name is 3-ethyl-1-phenyl-6-(4-piperazin-1-ylpiperidin-1-yl)indazole;hydrochloride.
| Compound Name | 3-ethyl-1-phenyl-6-(4-piperazin-1-ylpiperidin-1-yl)indazole;hydrochloride |
|---|---|
| PubChem CID | 67448706 |
| Molecular Formula | C24H32ClN5 |
| Molecular Weight | 426.01 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-ethyl-1-phenyl-6-(4-piperazin-1-ylpiperidin-1-yl)indazole;hydrochloride |
| SMILES | CCc1nn(-c2ccccc2)c2cc(N3CCC(N4CCNCC4)CC3)ccc12.Cl |
| InChI | InChI=1S/C24H31N5.ClH/c1-2-23-22-9-8-21(18-24(22)29(26-23)20-6-4-3-5-7-20)27-14-10-19(11-15-27)28-16-12-25-13-17-28;/h3-9,18-19,25H,2,10-17H2,1H3;1H |
| InChIKey | LTLYIQOOXPECBL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.01 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |