C17H25BFNO4 — CID 67448987
2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl-methylcarbamic acid (PubChem CID 67448987) has the molecular formula C17H25BFNO4 and a molecular weight of 337.20 g/mol. Its IUPAC name is 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl-methylcarbamic acid.
| Compound Name | 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl-methylcarbamic acid |
|---|---|
| PubChem CID | 67448987 |
| Molecular Formula | C17H25BFNO4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl-methylcarbamic acid |
| SMILES | CC(CN(C)C(=O)O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C17H25BFNO4/c1-11(10-20(6)15(21)22)13-8-7-12(9-14(13)19)18-23-16(2,3)17(4,5)24-18/h7-9,11H,10H2,1-6H3,(H,21,22) |
| InChIKey | YHVPYSFCVKIPGO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|