About 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine
2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine (PubChem CID 67449198) has the molecular formula C11H18N6
and a molecular weight of 234.31 g/mol. Its IUPAC name is 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine |
| PubChem CID | 67449198 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine |
| SMILES | CCC1=C(N)NC(CC)(n2cccn2)N=C1N |
| InChI | InChI=1S/C11H18N6/c1-3-8-9(12)15-11(4-2,16-10(8)13)17-7-5-6-14-17/h5-7,15H,3-4,12H2,1-2H3,(H2,13,16) |
| InChIKey | KULDAGLTAPURNK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine?
The IUPAC name of 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine (CID 67449198) is 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine.
What is the SMILES notation for 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine?
The canonical SMILES for 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine is CCC1=C(N)NC(CC)(n2cccn2)N=C1N.
What is the InChIKey of 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine?
The InChIKey is KULDAGLTAPURNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N6/c1-3-8-9(12)15-11(4-2,16-10(8)13)17-7-5-6-14-17/h5-7,15H,3-4,12H2,1-2H3,(H2,13,16).
What are the key properties of 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine?
2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine has a molecular weight of 234.31 g/mol, XLogP of 0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethyl-2-pyrazol-1-yl-1H-pyrimidine-4,6-diamine is sourced from PubChem (CID 67449198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).