C14H16N4O4 — CID 67449201
3-benzyl-4,7-dioxo-6,8,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide (PubChem CID 67449201) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-benzyl-4,7-dioxo-6,8,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide.
| Compound Name | 3-benzyl-4,7-dioxo-6,8,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide |
|---|---|
| PubChem CID | 67449201 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-benzyl-4,7-dioxo-6,8,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide |
| SMILES | NC(=O)N1OC(Cc2ccccc2)C(=O)N2CC(=O)NCC21 |
| InChI | InChI=1S/C14H16N4O4/c15-14(21)18-12-7-16-11(19)8-17(12)13(20)10(22-18)6-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2,(H2,15,21)(H,16,19) |
| InChIKey | FXBKZKSFUJPKPG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |