About 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine
5-(2,2-difluoroethyl)-1H-pyrazol-4-amine (PubChem CID 67451195) has the molecular formula C5H7F2N3
and a molecular weight of 147.13 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine |
| PubChem CID | 67451195 |
| Molecular Formula | C5H7F2N3 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine |
| SMILES | Nc1cn[nH]c1CC(F)F |
| InChI | InChI=1S/C5H7F2N3/c6-5(7)1-4-3(8)2-9-10-4/h2,5H,1,8H2,(H,9,10) |
| InChIKey | BMVDIDNPPRMUCT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine?
The IUPAC name of 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine (CID 67451195) is 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine.
What is the SMILES notation for 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine?
The canonical SMILES for 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine is Nc1cn[nH]c1CC(F)F.
What is the InChIKey of 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine?
The InChIKey is BMVDIDNPPRMUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3/c6-5(7)1-4-3(8)2-9-10-4/h2,5H,1,8H2,(H,9,10).
What are the key properties of 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine?
5-(2,2-difluoroethyl)-1H-pyrazol-4-amine has a molecular weight of 147.13 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethyl)-1H-pyrazol-4-amine is sourced from PubChem (CID 67451195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).