C9H12N2 — CID 67451485
6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepine (PubChem CID 67451485) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepine.
| Compound Name | 6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepine |
|---|---|
| PubChem CID | 67451485 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepine |
| SMILES | c1cnc2c(c1)CCCNC2 |
| InChI | InChI=1S/C9H12N2/c1-3-8-4-2-6-11-9(8)7-10-5-1/h2,4,6,10H,1,3,5,7H2 |
| InChIKey | BKQOMLORWCLWHP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |