About [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid
[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid (PubChem CID 67451682) has the molecular formula C10H7BF3NO2S
and a molecular weight of 273.04 g/mol. Its IUPAC name is [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid.
Molecular Properties
| Compound Name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid |
| PubChem CID | 67451682 |
| Molecular Formula | C10H7BF3NO2S |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid |
| SMILES | OB(O)c1cnc(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C10H7BF3NO2S/c12-10(13,14)7-3-1-6(2-4-7)9-15-5-8(18-9)11(16)17/h1-5,16-17H |
| InChIKey | WYRUVGLOBMXCGW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid?
The IUPAC name of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid (CID 67451682) is [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid.
What is the SMILES notation for [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid?
The canonical SMILES for [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid is OB(O)c1cnc(-c2ccc(C(F)(F)F)cc2)s1.
What is the InChIKey of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid?
The InChIKey is WYRUVGLOBMXCGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BF3NO2S/c12-10(13,14)7-3-1-6(2-4-7)9-15-5-8(18-9)11(16)17/h1-5,16-17H.
What are the key properties of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid?
[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid has a molecular weight of 273.04 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]boronic acid is sourced from PubChem (CID 67451682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).