C19H29BFNO4 — CID 67451964
[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutyl]-methylcarbamic acid (PubChem CID 67451964) has the molecular formula C19H29BFNO4 and a molecular weight of 365.25 g/mol. Its IUPAC name is [2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutyl]-methylcarbamic acid.
| Compound Name | [2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67451964 |
| Molecular Formula | C19H29BFNO4 |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutyl]-methylcarbamic acid |
| SMILES | CC(C)C(CN(C)C(=O)O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H29BFNO4/c1-12(2)15(11-22(7)17(23)24)14-9-8-13(10-16(14)21)20-25-18(3,4)19(5,6)26-20/h8-10,12,15H,11H2,1-7H3,(H,23,24) |
| InChIKey | WPURKJXUODCAOR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|