About methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate
methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 67452133) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 67452133 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)C1COC(C2CC2)=N1 |
| InChI | InChI=1S/C8H11NO3/c1-11-8(10)6-4-12-7(9-6)5-2-3-5/h5-6H,2-4H2,1H3 |
| InChIKey | ASSODJYRMBAHEV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 67452133) is methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate is COC(=O)C1COC(C2CC2)=N1.
What is the InChIKey of methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is ASSODJYRMBAHEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-11-8(10)6-4-12-7(9-6)5-2-3-5/h5-6H,2-4H2,1H3.
What are the key properties of methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopropyl-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 67452133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).