About 4-(methoxymethyl)-1,3-oxazinan-2-one
4-(methoxymethyl)-1,3-oxazinan-2-one (PubChem CID 67452181) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 4-(methoxymethyl)-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-1,3-oxazinan-2-one |
| PubChem CID | 67452181 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 4-(methoxymethyl)-1,3-oxazinan-2-one |
| SMILES | COCC1CCOC(=O)N1 |
| InChI | InChI=1S/C6H11NO3/c1-9-4-5-2-3-10-6(8)7-5/h5H,2-4H2,1H3,(H,7,8) |
| InChIKey | FSKNDIUGYSBCSK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(methoxymethyl)-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-1,3-oxazinan-2-one?
The IUPAC name of 4-(methoxymethyl)-1,3-oxazinan-2-one (CID 67452181) is 4-(methoxymethyl)-1,3-oxazinan-2-one.
What is the SMILES notation for 4-(methoxymethyl)-1,3-oxazinan-2-one?
The canonical SMILES for 4-(methoxymethyl)-1,3-oxazinan-2-one is COCC1CCOC(=O)N1.
What is the InChIKey of 4-(methoxymethyl)-1,3-oxazinan-2-one?
The InChIKey is FSKNDIUGYSBCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-9-4-5-2-3-10-6(8)7-5/h5H,2-4H2,1H3,(H,7,8).
What are the key properties of 4-(methoxymethyl)-1,3-oxazinan-2-one?
4-(methoxymethyl)-1,3-oxazinan-2-one has a molecular weight of 145.16 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-1,3-oxazinan-2-one is sourced from PubChem (CID 67452181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).