C19H26BN3O3 — CID 67452254
1-ethyl-3-[8-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-yl]urea (PubChem CID 67452254) has the molecular formula C19H26BN3O3 and a molecular weight of 355.25 g/mol. Its IUPAC name is 1-ethyl-3-[8-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-yl]urea.
| Compound Name | 1-ethyl-3-[8-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-yl]urea |
|---|---|
| PubChem CID | 67452254 |
| Molecular Formula | C19H26BN3O3 |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-ethyl-3-[8-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-yl]urea |
| SMILES | CCNC(=O)Nc1cc2c(B3OC(C)(C)C(C)(C)O3)ccc(C)c2cn1 |
| InChI | InChI=1S/C19H26BN3O3/c1-7-21-17(24)23-16-10-13-14(11-22-16)12(2)8-9-15(13)20-25-18(3,4)19(5,6)26-20/h8-11H,7H2,1-6H3,(H2,21,22,23,24) |
| InChIKey | PNIOUXOQPXSWKC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|