C15H17FN4O4 — CID 67452693
ethyl [4-[(3-fluoro-4-methylphenyl)carbamoylamino]-1-methylimidazol-2-yl] carbonate (PubChem CID 67452693) has the molecular formula C15H17FN4O4 and a molecular weight of 336.32 g/mol. Its IUPAC name is ethyl [4-[(3-fluoro-4-methylphenyl)carbamoylamino]-1-methylimidazol-2-yl] carbonate.
| Compound Name | ethyl [4-[(3-fluoro-4-methylphenyl)carbamoylamino]-1-methylimidazol-2-yl] carbonate |
|---|---|
| PubChem CID | 67452693 |
| Molecular Formula | C15H17FN4O4 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | ethyl [4-[(3-fluoro-4-methylphenyl)carbamoylamino]-1-methylimidazol-2-yl] carbonate |
| SMILES | CCOC(=O)Oc1nc(NC(=O)Nc2ccc(C)c(F)c2)cn1C |
| InChI | InChI=1S/C15H17FN4O4/c1-4-23-15(22)24-14-19-12(8-20(14)3)18-13(21)17-10-6-5-9(2)11(16)7-10/h5-8H,4H2,1-3H3,(H2,17,18,21) |
| InChIKey | ZJZKCVZLMWYBLC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |