C11H13NO — CID 67453041
3-aminotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-ol (PubChem CID 67453041) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-aminotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-ol.
| Compound Name | 3-aminotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-ol |
|---|---|
| PubChem CID | 67453041 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-aminotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-ol |
| SMILES | Nc1cccc2c1C1CCC2C1O |
| InChI | InChI=1S/C11H13NO/c12-9-3-1-2-6-7-4-5-8(10(6)9)11(7)13/h1-3,7-8,11,13H,4-5,12H2 |
| InChIKey | YBZXBSKENHXTJH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|