C18H21N3O2 — CID 67453116
2-methyl-4-[2-(6-methyl-2-pyridinyl)ethenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 67453116) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-methyl-4-[2-(6-methyl-2-pyridinyl)ethenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | 2-methyl-4-[2-(6-methyl-2-pyridinyl)ethenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 67453116 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-methyl-4-[2-(6-methyl-2-pyridinyl)ethenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | Cc1cccc(C=CC2C3C(=O)N(C)C(=O)C3C3CCCN23)n1 |
| InChI | InChI=1S/C18H21N3O2/c1-11-5-3-6-12(19-11)8-9-14-16-15(13-7-4-10-21(13)14)17(22)20(2)18(16)23/h3,5-6,8-9,13-16H,4,7,10H2,1-2H3 |
| InChIKey | UCJYGOQKPYVFBN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|