C24H31N3O2 — CID 67453444
5-(4-tert-butylphenyl)-5-cyano-2,2-dimethyl-4-(2,4,5-trimethylpyrazol-3-yl)pent-4-enoic acid (PubChem CID 67453444) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-5-cyano-2,2-dimethyl-4-(2,4,5-trimethylpyrazol-3-yl)pent-4-enoic acid.
| Compound Name | 5-(4-tert-butylphenyl)-5-cyano-2,2-dimethyl-4-(2,4,5-trimethylpyrazol-3-yl)pent-4-enoic acid |
|---|---|
| PubChem CID | 67453444 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 5-(4-tert-butylphenyl)-5-cyano-2,2-dimethyl-4-(2,4,5-trimethylpyrazol-3-yl)pent-4-enoic acid |
| SMILES | Cc1nn(C)c(C(CC(C)(C)C(=O)O)=C(C#N)c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C24H31N3O2/c1-15-16(2)26-27(8)21(15)19(13-24(6,7)22(28)29)20(14-25)17-9-11-18(12-10-17)23(3,4)5/h9-12H,13H2,1-8H3,(H,28,29) |
| InChIKey | TXYJQSBSEZAWEJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|