C25H33F2N5O7S — CID 67453777
(E)-3-[4-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 67453777) has the molecular formula C25H33F2N5O7S and a molecular weight of 585.63 g/mol. Its IUPAC name is (E)-3-[4-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | (E)-3-[4-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 67453777 |
| Molecular Formula | C25H33F2N5O7S |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | (E)-3-[4-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NCCOCCOCCOCCN)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C25H33F2N5O7S/c1-17(24(33)32-25(29)30)14-18-15-21(26)23(22(27)16-18)39-19-2-4-20(5-3-19)40(34,35)31-7-9-37-11-13-38-12-10-36-8-6-28/h2-5,14-16,31H,6-13,28H2,1H3,(H4,29,30,32,33)/b17-14+ |
| InChIKey | PHPJDFTXBBRTHD-SAPNQHFASA-N |
| XLogP | 1.25 |
| TPSA | 190.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|