C23H29FN4O3 — CID 67453815
butyl N-[6-(1-ethoxyethenyl)pyridazin-3-yl]-N-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]carbamate (PubChem CID 67453815) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is butyl N-[6-(1-ethoxyethenyl)pyridazin-3-yl]-N-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]carbamate.
| Compound Name | butyl N-[6-(1-ethoxyethenyl)pyridazin-3-yl]-N-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]carbamate |
|---|---|
| PubChem CID | 67453815 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | butyl N-[6-(1-ethoxyethenyl)pyridazin-3-yl]-N-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]carbamate |
| SMILES | C=C(OCC)c1ccc(N(CC2(c3ncccc3F)CCC2)C(=O)OCCCC)nn1 |
| InChI | InChI=1S/C23H29FN4O3/c1-4-6-15-31-22(29)28(20-11-10-19(26-27-20)17(3)30-5-2)16-23(12-8-13-23)21-18(24)9-7-14-25-21/h7,9-11,14H,3-6,8,12-13,15-16H2,1-2H3 |
| InChIKey | ZBZOSBNWQZKFPD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|