About bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine
bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine (PubChem CID 67454574) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine |
| PubChem CID | 67454574 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine |
| SMILES | CCN(C)C.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C4H11N/c1-2-5-4-6(5)3-1;1-4-5(2)3/h1-4H;4H2,1-3H3 |
| InChIKey | VUJSLGVUUQVDKH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine (CID 67454574) is bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine is CCN(C)C.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine?
The InChIKey is VUJSLGVUUQVDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C4H11N/c1-2-5-4-6(5)3-1;1-4-5(2)3/h1-4H;4H2,1-3H3.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine?
bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine has a molecular weight of 149.24 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;N,N-dimethylethanamine is sourced from PubChem (CID 67454574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).