About N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine
N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine (PubChem CID 67454849) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine.
Molecular Properties
| Compound Name | N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine |
| PubChem CID | 67454849 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine |
| SMILES | CNc1ccnc2c1CC2 |
| InChI | InChI=1S/C8H10N2/c1-9-7-4-5-10-8-3-2-6(7)8/h4-5H,2-3H2,1H3,(H,9,10) |
| InChIKey | LHXKGLIAMIXNTM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine?
The IUPAC name of N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine (CID 67454849) is N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine.
What is the SMILES notation for N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine?
The canonical SMILES for N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine is CNc1ccnc2c1CC2.
What is the InChIKey of N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine?
The InChIKey is LHXKGLIAMIXNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-9-7-4-5-10-8-3-2-6(7)8/h4-5H,2-3H2,1H3,(H,9,10).
What are the key properties of N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine?
N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine has a molecular weight of 134.18 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-5-amine is sourced from PubChem (CID 67454849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).