About (5-bromothiophen-2-yl) ethyl carbonate
(5-bromothiophen-2-yl) ethyl carbonate (PubChem CID 67455175) has the molecular formula C7H7BrO3S
and a molecular weight of 251.10 g/mol. Its IUPAC name is (5-bromothiophen-2-yl) ethyl carbonate.
Molecular Properties
| Compound Name | (5-bromothiophen-2-yl) ethyl carbonate |
| PubChem CID | 67455175 |
| Molecular Formula | C7H7BrO3S |
| Molecular Weight | 251.10 g/mol |
| Exact Mass | 249.93 |
| IUPAC Name | (5-bromothiophen-2-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(Br)s1 |
| InChI | InChI=1S/C7H7BrO3S/c1-2-10-7(9)11-6-4-3-5(8)12-6/h3-4H,2H2,1H3 |
| InChIKey | QHRZPIGTDTWEIO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.10 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-bromothiophen-2-yl) ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromothiophen-2-yl) ethyl carbonate?
The IUPAC name of (5-bromothiophen-2-yl) ethyl carbonate (CID 67455175) is (5-bromothiophen-2-yl) ethyl carbonate.
What is the SMILES notation for (5-bromothiophen-2-yl) ethyl carbonate?
The canonical SMILES for (5-bromothiophen-2-yl) ethyl carbonate is CCOC(=O)Oc1ccc(Br)s1.
What is the InChIKey of (5-bromothiophen-2-yl) ethyl carbonate?
The InChIKey is QHRZPIGTDTWEIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO3S/c1-2-10-7(9)11-6-4-3-5(8)12-6/h3-4H,2H2,1H3.
What are the key properties of (5-bromothiophen-2-yl) ethyl carbonate?
(5-bromothiophen-2-yl) ethyl carbonate has a molecular weight of 251.10 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromothiophen-2-yl) ethyl carbonate is sourced from PubChem (CID 67455175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).