About 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole
1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole (PubChem CID 674556) has the molecular formula C9H6Cl2N4O2
and a molecular weight of 273.08 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole |
| PubChem CID | 674556 |
| Molecular Formula | C9H6Cl2N4O2 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ncn(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C9H6Cl2N4O2/c10-7-2-1-3-8(11)6(7)4-14-5-12-9(13-14)15(16)17/h1-3,5H,4H2 |
| InChIKey | XFTCCBVLBULIOJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole?
The IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole (CID 674556) is 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole.
What is the SMILES notation for 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole?
The canonical SMILES for 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole is O=[N+]([O-])c1ncn(Cc2c(Cl)cccc2Cl)n1.
What is the InChIKey of 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole?
The InChIKey is XFTCCBVLBULIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N4O2/c10-7-2-1-3-8(11)6(7)4-14-5-12-9(13-14)15(16)17/h1-3,5H,4H2.
What are the key properties of 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole?
1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole has a molecular weight of 273.08 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dichlorophenyl)methyl]-3-nitro-1,2,4-triazole is sourced from PubChem (CID 674556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).