C21H23F2N5O6S — CID 67456507
(E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-(2-methoxyethylcarbamoylsulfamoyl)phenoxy]phenyl]-2-methylprop-2-enamide (PubChem CID 67456507) has the molecular formula C21H23F2N5O6S and a molecular weight of 511.51 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-(2-methoxyethylcarbamoylsulfamoyl)phenoxy]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-(2-methoxyethylcarbamoylsulfamoyl)phenoxy]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 67456507 |
| Molecular Formula | C21H23F2N5O6S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-(2-methoxyethylcarbamoylsulfamoyl)phenoxy]phenyl]-2-methylprop-2-enamide |
| SMILES | COCCNC(=O)NS(=O)(=O)c1ccc(Oc2c(F)cc(/C=C(\C)C(=O)N=C(N)N)cc2F)cc1 |
| InChI | InChI=1S/C21H23F2N5O6S/c1-12(19(29)27-20(24)25)9-13-10-16(22)18(17(23)11-13)34-14-3-5-15(6-4-14)35(31,32)28-21(30)26-7-8-33-2/h3-6,9-11H,7-8H2,1-2H3,(H2,26,28,30)(H4,24,25,27,29)/b12-9+ |
| InChIKey | IVEWCDNILFGHAV-FMIVXFBMSA-N |
| XLogP | 1.59 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|