About 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one
1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one (PubChem CID 67456724) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one |
| PubChem CID | 67456724 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one |
| SMILES | COCCc1cc2c([nH]c(=O)n2Cc2ccccc2)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C23H24N4O2/c1-29-13-12-19-14-20-21(22(25-19)24-15-17-8-4-2-5-9-17)26-23(28)27(20)16-18-10-6-3-7-11-18/h2-11,14H,12-13,15-16H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | MRKOCDLRDJYCKI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one?
The IUPAC name of 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one (CID 67456724) is 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one.
What is the SMILES notation for 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one?
The canonical SMILES for 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one is COCCc1cc2c([nH]c(=O)n2Cc2ccccc2)c(NCc2ccccc2)n1.
What is the InChIKey of 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one?
The InChIKey is MRKOCDLRDJYCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-29-13-12-19-14-20-21(22(25-19)24-15-17-8-4-2-5-9-17)26-23(28)27(20)16-18-10-6-3-7-11-18/h2-11,14H,12-13,15-16H2,1H3,(H,24,25)(H,26,28).
What are the key properties of 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one?
1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one has a molecular weight of 388.47 g/mol, XLogP of 3.57, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(benzylamino)-6-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-one is sourced from PubChem (CID 67456724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).