C16H22O11 — CID 67456962
1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one (PubChem CID 67456962) has the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. Its IUPAC name is 1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one.
| Compound Name | 1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 67456962 |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C(O)[C@H]1OC(O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C16H22O11/c1-6(17)11(22)12-13(23,7(2)18)14(24,8(3)19)15(25,9(4)20)16(26,27-12)10(5)21/h11-12,22-26H,1-5H3/t11?,12-,13-,14+,15+,16?/m1/s1 |
| InChIKey | XIDZOJLMCZAHNF-YBTKQCQXSA-N |
| XLogP | -3.43 |
| TPSA | 195.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |