About 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride
1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride (PubChem CID 67457005) has the molecular formula C17H12ClNOS
and a molecular weight of 313.81 g/mol. Its IUPAC name is 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride |
| PubChem CID | 67457005 |
| Molecular Formula | C17H12ClNOS |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2ccccc2c2c(-c3ccccc3)csc12 |
| InChI | InChI=1S/C17H11NOS.ClH/c19-17-16-15(12-8-4-5-9-14(12)18-17)13(10-20-16)11-6-2-1-3-7-11;/h1-10H,(H,18,19);1H |
| InChIKey | ALZMTSYTTSDLSB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride?
The IUPAC name of 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride (CID 67457005) is 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride.
What is the SMILES notation for 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride?
The canonical SMILES for 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride is Cl.O=c1[nH]c2ccccc2c2c(-c3ccccc3)csc12.
What is the InChIKey of 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride?
The InChIKey is ALZMTSYTTSDLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NOS.ClH/c19-17-16-15(12-8-4-5-9-14(12)18-17)13(10-20-16)11-6-2-1-3-7-11;/h1-10H,(H,18,19);1H.
What are the key properties of 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride?
1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride has a molecular weight of 313.81 g/mol, XLogP of 4.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5H-thieno[2,3-c]quinolin-4-one;hydrochloride is sourced from PubChem (CID 67457005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).