About 3,3-difluoroazepane
3,3-difluoroazepane (PubChem CID 67457127) has the molecular formula C6H11F2N
and a molecular weight of 135.16 g/mol. Its IUPAC name is 3,3-difluoroazepane.
Molecular Properties
| Compound Name | 3,3-difluoroazepane |
| PubChem CID | 67457127 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3,3-difluoroazepane |
| SMILES | FC1(F)CCCCNC1 |
| InChI | InChI=1S/C6H11F2N/c7-6(8)3-1-2-4-9-5-6/h9H,1-5H2 |
| InChIKey | FVWMDLFXICQWEG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoroazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoroazepane?
The IUPAC name of 3,3-difluoroazepane (CID 67457127) is 3,3-difluoroazepane.
What is the SMILES notation for 3,3-difluoroazepane?
The canonical SMILES for 3,3-difluoroazepane is FC1(F)CCCCNC1.
What is the InChIKey of 3,3-difluoroazepane?
The InChIKey is FVWMDLFXICQWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N/c7-6(8)3-1-2-4-9-5-6/h9H,1-5H2.
What are the key properties of 3,3-difluoroazepane?
3,3-difluoroazepane has a molecular weight of 135.16 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoroazepane is sourced from PubChem (CID 67457127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).