C25H27ClF3N7O4 — CID 67457854
4-[4-[3-[6-chloro-2-(diaminomethylideneamino)quinazolin-4-yl]phenyl]piperazin-1-yl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67457854) has the molecular formula C25H27ClF3N7O4 and a molecular weight of 581.98 g/mol. Its IUPAC name is 4-[4-[3-[6-chloro-2-(diaminomethylideneamino)quinazolin-4-yl]phenyl]piperazin-1-yl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[3-[6-chloro-2-(diaminomethylideneamino)quinazolin-4-yl]phenyl]piperazin-1-yl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67457854 |
| Molecular Formula | C25H27ClF3N7O4 |
| Molecular Weight | 581.98 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 4-[4-[3-[6-chloro-2-(diaminomethylideneamino)quinazolin-4-yl]phenyl]piperazin-1-yl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=Nc1nc(-c2cccc(N3CCN(CCCC(=O)O)CC3)c2)c2cc(Cl)ccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26ClN7O2.C2HF3O2/c24-16-6-7-19-18(14-16)21(28-23(27-19)29-22(25)26)15-3-1-4-17(13-15)31-11-9-30(10-12-31)8-2-5-20(32)33;3-2(4,5)1(6)7/h1,3-4,6-7,13-14H,2,5,8-12H2,(H,32,33)(H4,25,26,27,28,29);(H,6,7) |
| InChIKey | ISZRRUHHVDFOHN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 171.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.98 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|