About 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine
2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine (PubChem CID 67457871) has the molecular formula C24H28N4
and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine.
Molecular Properties
| Compound Name | 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine |
| PubChem CID | 67457871 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine |
| SMILES | CC1=CC=CC23NC(CCc4ccc(C(C)(C)N)cc4)=CC=C2C(N)=CN=C13 |
| InChI | InChI=1S/C24H28N4/c1-16-5-4-14-24-20(21(25)15-27-22(16)24)13-12-19(28-24)11-8-17-6-9-18(10-7-17)23(2,3)26/h4-7,9-10,12-15,28H,8,11,25-26H2,1-3H3 |
| InChIKey | HBSWLWFBFZESAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine?
The IUPAC name of 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine (CID 67457871) is 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine.
What is the SMILES notation for 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine?
The canonical SMILES for 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine is CC1=CC=CC23NC(CCc4ccc(C(C)(C)N)cc4)=CC=C2C(N)=CN=C13.
What is the InChIKey of 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine?
The InChIKey is HBSWLWFBFZESAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4/c1-16-5-4-14-24-20(21(25)15-27-22(16)24)13-12-19(28-24)11-8-17-6-9-18(10-7-17)23(2,3)26/h4-7,9-10,12-15,28H,8,11,25-26H2,1-3H3.
What are the key properties of 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine?
2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine has a molecular weight of 372.52 g/mol, XLogP of 3.74, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(2-aminopropan-2-yl)phenyl]ethyl]-8-methyl-1H-benzo[i][1,7]naphthyridin-5-amine is sourced from PubChem (CID 67457871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).