C18H20Cl2N3O4P — CID 67457888
[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]methylphosphonic acid (PubChem CID 67457888) has the molecular formula C18H20Cl2N3O4P and a molecular weight of 444.26 g/mol. Its IUPAC name is [[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]methylphosphonic acid.
| Compound Name | [[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 67457888 |
| Molecular Formula | C18H20Cl2N3O4P |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | [[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]methylphosphonic acid |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc(NC(=O)NCP(=O)(O)O)cc2)C1 |
| InChI | InChI=1S/C18H20Cl2N3O4P/c1-23-8-15(14-6-12(19)7-17(20)16(14)9-23)11-2-4-13(5-3-11)22-18(24)21-10-28(25,26)27/h2-7,15H,8-10H2,1H3,(H2,21,22,24)(H2,25,26,27) |
| InChIKey | HOUHDYXFASSFMI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|