About methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate
methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 67458709) has the molecular formula C17H21F2NO5
and a molecular weight of 357.35 g/mol. Its IUPAC name is methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
Molecular Properties
| Compound Name | methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| PubChem CID | 67458709 |
| Molecular Formula | C17H21F2NO5 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | COC(=O)[C@H](CCC(=O)c1ccc(F)c(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21F2NO5/c1-17(2,3)25-16(23)20-13(15(22)24-4)7-8-14(21)10-5-6-11(18)12(19)9-10/h5-6,9,13H,7-8H2,1-4H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | XIWQSNQYYMQENV-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
The IUPAC name of methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (CID 67458709) is methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
What is the SMILES notation for methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
The canonical SMILES for methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate is COC(=O)[C@H](CCC(=O)c1ccc(F)c(F)c1)NC(=O)OC(C)(C)C.
What is the InChIKey of methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
The InChIKey is XIWQSNQYYMQENV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H21F2NO5/c1-17(2,3)25-16(23)20-13(15(22)24-4)7-8-14(21)10-5-6-11(18)12(19)9-10/h5-6,9,13H,7-8H2,1-4H3,(H,20,23)/t13-/m0/s1.
What are the key properties of methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate?
methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate has a molecular weight of 357.35 g/mol, XLogP of 2.99, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-5-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate is sourced from PubChem (CID 67458709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).