C17H20N6O — CID 67458765
5-methyl-2-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]-1,3-oxazole (PubChem CID 67458765) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 5-methyl-2-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]-1,3-oxazole.
| Compound Name | 5-methyl-2-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 67458765 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 5-methyl-2-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]-1,3-oxazole |
| SMILES | Cc1cnc(C2CN(c3c4c(nc5ccnn35)CCNCC4)C2)o1 |
| InChI | InChI=1S/C17H20N6O/c1-11-8-19-16(24-11)12-9-22(10-12)17-13-2-5-18-6-3-14(13)21-15-4-7-20-23(15)17/h4,7-8,12,18H,2-3,5-6,9-10H2,1H3 |
| InChIKey | UCZOFOGTEILDDJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |