About propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate
propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate (PubChem CID 67458997) has the molecular formula C16H19F3N2O6S
and a molecular weight of 424.40 g/mol. Its IUPAC name is propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate.
Molecular Properties
| Compound Name | propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate |
| PubChem CID | 67458997 |
| Molecular Formula | C16H19F3N2O6S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate |
| SMILES | CCCOC(=O)N(c1ccccc1CN1CCCOC1=O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O6S/c1-2-9-26-15(23)21(28(24,25)16(17,18)19)13-7-4-3-6-12(13)11-20-8-5-10-27-14(20)22/h3-4,6-7H,2,5,8-11H2,1H3 |
| InChIKey | NVXFZXZQKRFNQU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate?
The IUPAC name of propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate (CID 67458997) is propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate.
What is the SMILES notation for propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate?
The canonical SMILES for propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate is CCCOC(=O)N(c1ccccc1CN1CCCOC1=O)S(=O)(=O)C(F)(F)F.
What is the InChIKey of propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate?
The InChIKey is NVXFZXZQKRFNQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3N2O6S/c1-2-9-26-15(23)21(28(24,25)16(17,18)19)13-7-4-3-6-12(13)11-20-8-5-10-27-14(20)22/h3-4,6-7H,2,5,8-11H2,1H3.
What are the key properties of propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate?
propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate has a molecular weight of 424.40 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-[2-[(2-oxo-1,3-oxazinan-3-yl)methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate is sourced from PubChem (CID 67458997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).