C26H25F3N2O4 — CID 67459069
ethyl 2-[5-[2-[[acetyl(benzyl)amino]methyl]-4-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-3-yl]acetate (PubChem CID 67459069) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is ethyl 2-[5-[2-[[acetyl(benzyl)amino]methyl]-4-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-3-yl]acetate.
| Compound Name | ethyl 2-[5-[2-[[acetyl(benzyl)amino]methyl]-4-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-3-yl]acetate |
|---|---|
| PubChem CID | 67459069 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | ethyl 2-[5-[2-[[acetyl(benzyl)amino]methyl]-4-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(-c2ccc(C(F)(F)F)cc2CN(Cc2ccccc2)C(C)=O)c[n+]([O-])c1 |
| InChI | InChI=1S/C26H25F3N2O4/c1-3-35-25(33)12-20-11-21(17-31(34)15-20)24-10-9-23(26(27,28)29)13-22(24)16-30(18(2)32)14-19-7-5-4-6-8-19/h4-11,13,15,17H,3,12,14,16H2,1-2H3 |
| InChIKey | USRBGDVJOBDPBO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|