C17H23N3 — CID 67459074
(1S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene (PubChem CID 67459074) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is (1S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene.
| Compound Name | (1S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene |
|---|---|
| PubChem CID | 67459074 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | (1S)-1,7,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene |
| SMILES | Cn1cnc2cc3c(cc21)CC1NCC[C@]3(C)C1(C)C |
| InChI | InChI=1S/C17H23N3/c1-16(2)15-8-11-7-14-13(19-10-20(14)4)9-12(11)17(16,3)5-6-18-15/h7,9-10,15,18H,5-6,8H2,1-4H3/t15?,17-/m0/s1 |
| InChIKey | QDXIAPPZXGGVGN-LWKPJOBUSA-N |
| XLogP | 2.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |