C27H27Cl2FN6O2 — CID 67459191
tert-butyl 4-[4-[1-[(Z)-(2,6-dichloro-3-fluorophenyl)methylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 67459191) has the molecular formula C27H27Cl2FN6O2 and a molecular weight of 557.46 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-[(Z)-(2,6-dichloro-3-fluorophenyl)methylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[1-[(Z)-(2,6-dichloro-3-fluorophenyl)methylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67459191 |
| Molecular Formula | C27H27Cl2FN6O2 |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | tert-butyl 4-[4-[1-[(Z)-(2,6-dichloro-3-fluorophenyl)methylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3cnc4ccn(/N=C\c5c(Cl)ccc(F)c5Cl)c4c3)cn2)CC1 |
| InChI | InChI=1S/C27H27Cl2FN6O2/c1-27(2,3)38-26(37)34-9-6-19(7-10-34)36-16-18(14-32-36)17-12-24-23(31-13-17)8-11-35(24)33-15-20-21(28)4-5-22(30)25(20)29/h4-5,8,11-16,19H,6-7,9-10H2,1-3H3/b33-15- |
| InChIKey | GDKUAQQXGYUPJI-UHIZKJEFSA-N |
| XLogP | 6.80 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|