C20H21F2N4O9PS — CID 67459203
2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonyl-(phosphonomethyl)amino]acetic acid (PubChem CID 67459203) has the molecular formula C20H21F2N4O9PS and a molecular weight of 562.44 g/mol. Its IUPAC name is 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonyl-(phosphonomethyl)amino]acetic acid.
| Compound Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonyl-(phosphonomethyl)amino]acetic acid |
|---|---|
| PubChem CID | 67459203 |
| Molecular Formula | C20H21F2N4O9PS |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonyl-(phosphonomethyl)amino]acetic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)N(CC(=O)O)CP(=O)(O)O)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C20H21F2N4O9PS/c1-11(19(29)25-20(23)24)6-12-7-15(21)18(16(22)8-12)35-13-2-4-14(5-3-13)37(33,34)26(9-17(27)28)10-36(30,31)32/h2-8H,9-10H2,1H3,(H,27,28)(H2,30,31,32)(H4,23,24,25,29)/b11-6+ |
| InChIKey | ZIMKYSVLFRGPBA-IZZDOVSWSA-N |
| XLogP | 1.17 |
| TPSA | 222.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|