C18H23N3O4 — CID 67459493
oxalic acid;1-[2-(4-phenylpyrazol-1-yl)ethyl]piperidine (PubChem CID 67459493) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is oxalic acid;1-[2-(4-phenylpyrazol-1-yl)ethyl]piperidine.
| Compound Name | oxalic acid;1-[2-(4-phenylpyrazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 67459493 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | oxalic acid;1-[2-(4-phenylpyrazol-1-yl)ethyl]piperidine |
| SMILES | O=C(O)C(=O)O.c1ccc(-c2cnn(CCN3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C16H21N3.C2H2O4/c1-3-7-15(8-4-1)16-13-17-19(14-16)12-11-18-9-5-2-6-10-18;3-1(4)2(5)6/h1,3-4,7-8,13-14H,2,5-6,9-12H2;(H,3,4)(H,5,6) |
| InChIKey | CKWDXHFDGLMTPB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|