About 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one
2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one (PubChem CID 67459681) has the molecular formula C16H12BrN3O3
and a molecular weight of 374.19 g/mol. Its IUPAC name is 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one.
Molecular Properties
| Compound Name | 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one |
| PubChem CID | 67459681 |
| Molecular Formula | C16H12BrN3O3 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(O)ccc1Oc1ccc(Br)cc12 |
| InChI | InChI=1S/C16H12BrN3O3/c1-20-14(22)16(19-15(20)18)10-6-8(17)2-4-12(10)23-13-5-3-9(21)7-11(13)16/h2-7,21H,1H3,(H2,18,19) |
| InChIKey | HSPOQXGWMNGCSB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one?
The IUPAC name of 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one (CID 67459681) is 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one.
What is the SMILES notation for 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one?
The canonical SMILES for 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one is CN1C(=O)C2(N=C1N)c1cc(O)ccc1Oc1ccc(Br)cc12.
What is the InChIKey of 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one?
The InChIKey is HSPOQXGWMNGCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrN3O3/c1-20-14(22)16(19-15(20)18)10-6-8(17)2-4-12(10)23-13-5-3-9(21)7-11(13)16/h2-7,21H,1H3,(H2,18,19).
What are the key properties of 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one?
2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one has a molecular weight of 374.19 g/mol, XLogP of 2.29, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2'-bromo-7'-hydroxy-3-methylspiro[imidazole-5,9'-xanthene]-4-one is sourced from PubChem (CID 67459681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).