About (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one
(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one (PubChem CID 67459918) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one.
Molecular Properties
| Compound Name | (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one |
| PubChem CID | 67459918 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one |
| SMILES | O=C1CN[C@@H](C2C=CC(F)C(F)C2)C1 |
| InChI | InChI=1S/C10H13F2NO/c11-8-2-1-6(3-9(8)12)10-4-7(14)5-13-10/h1-2,6,8-10,13H,3-5H2/t6?,8?,9?,10-/m1/s1 |
| InChIKey | XEPPKVBLJHSMNO-NEEVAGLGSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one?
The IUPAC name of (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one (CID 67459918) is (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one.
What is the SMILES notation for (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one?
The canonical SMILES for (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one is O=C1CN[C@@H](C2C=CC(F)C(F)C2)C1.
What is the InChIKey of (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one?
The InChIKey is XEPPKVBLJHSMNO-NEEVAGLGSA-N. The full InChI is InChI=1S/C10H13F2NO/c11-8-2-1-6(3-9(8)12)10-4-7(14)5-13-10/h1-2,6,8-10,13H,3-5H2/t6?,8?,9?,10-/m1/s1.
What are the key properties of (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one?
(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one has a molecular weight of 201.22 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(4,5-difluorocyclohex-2-en-1-yl)pyrrolidin-3-one is sourced from PubChem (CID 67459918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).